CAS 16034-14-3 is the registry number for Dibenzyl isophthalate, 95%. Offered by: AmBeed. Available pack sizes: 5g.
Dibenzyl benzene-1,3-dicarboxylate (CAS 16034-14-3) is a chemical compound with the molecular formula C22H18O4 and a molecular weight of 346.4 g/mol. IUPAC name: dibenzyl benzene-1,3-dicarboxylate. InChIKey: OIVQLSUKOZNNCT-UHFFFAOYSA-N.
| Molecular formula | C22H18O4 |
|---|---|
| Molecular weight | 346.4 g/mol |
| IUPAC name | dibenzyl benzene-1,3-dicarboxylate |
| InChIKey | OIVQLSUKOZNNCT-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)C2=CC(=CC=C2)C(=O)OCC3=CC=CC=C3 |
Computed by PubChem (NCBI)