CAS 16064-24-7 appears in our catalog under these names: 7-Methoxyquinazolin-4-ol, 95%, 7–Methoxyquinazolin–4(1H)–one, 7-Methoxyquinazolin-4(1h)-one, 95%, 7-Methoxy-4(3h)-quinazolinone, 98%, 7-Methoxyquinazolin-4(1H)-one 95%. Offered by: Combi-blocks, GLPBio, Ambeed, Fluorochem, Chemat. Available pack sizes: 10g, 1g, 25g, 5g, 250mg, 100mg.
7-methoxy-3H-quinazolin-4-one (CAS 16064-24-7) is a chemical compound with the molecular formula C9H8N2O2 and a molecular weight of 176.17 g/mol. IUPAC name: 7-methoxy-3H-quinazolin-4-one. InChIKey: PPGWFCHOWMFNRI-UHFFFAOYSA-N.
| Molecular formula | C9H8N2O2 |
|---|---|
| Molecular weight | 176.17 g/mol |
| IUPAC name | 7-methoxy-3H-quinazolin-4-one |
| InChIKey | PPGWFCHOWMFNRI-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=C1)C(=O)NC=N2 |
Computed by PubChem (NCBI)