CAS 16077-09-1 appears in our catalog under these names: 5–methoxy–1–methylindoline–2,3–dione, 5-Methoxy-1-methylindoline-2,3-dione, 97%, 5-Methoxy-1-methyl-2,3-dihydro-1h-indole-2,3-dione, 95%. Offered by: GLPBio, AmBeed, Combi-blocks. Available pack sizes: 100mg, 1g, 250mg, 10g, 5g.
5-methoxy-1-methylindole-2,3-dione (CAS 16077-09-1) is a chemical compound with the molecular formula C10H9NO3 and a molecular weight of 191.18 g/mol. IUPAC name: 5-methoxy-1-methylindole-2,3-dione. InChIKey: CZRPSRARMQINMA-UHFFFAOYSA-N.
| Molecular formula | C10H9NO3 |
|---|---|
| Molecular weight | 191.18 g/mol |
| IUPAC name | 5-methoxy-1-methylindole-2,3-dione |
| InChIKey | CZRPSRARMQINMA-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C=C(C=C2)OC)C(=O)C1=O |
Computed by PubChem (NCBI)