Products 160885-93-8

CAS 160885-93-8 appears in our catalog under these names: 2–((((9H–Fluoren–9–yl)methoxy)carbonyl)amino)–2–methylbutanoic acid, 2-(Amino)-2-methylbutanoic acid. Offered by: GLPBio, Biosynth. Available pack sizes: 1g, 10g.

Structural formula: {0} (CAS {1})

2-(9H-fluoren-9-ylmethoxycarbonylamino)-2-methylbutanoic acid (CAS 160885-93-8) is a chemical compound with the molecular formula C20H21NO4 and a molecular weight of 339.4 g/mol. IUPAC name: 2-(9H-fluoren-9-ylmethoxycarbonylamino)-2-methylbutanoic acid. InChIKey: DZSLHAJXIQCMLR-UHFFFAOYSA-N.

Identity
Molecular formulaC20H21NO4
Molecular weight339.4 g/mol
IUPAC name2-(9H-fluoren-9-ylmethoxycarbonylamino)-2-methylbutanoic acid
InChIKeyDZSLHAJXIQCMLR-UHFFFAOYSA-N
SMILESCCC(C)(C(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13

Computed by PubChem (NCBI)