CAS 16091-26-2 appears in our catalog under these names: 3-Aminobenzanilide, 3-Aminobenzanilide 98%, 3'-Aminobenzanilide, 98%, 98%, 3'-Aminobenzanilide, 98%. Offered by: Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 0,25g, 2,5g, 1g, 5g, 10g, 25g, 100mg, 250mg.
N-(3-aminophenyl)benzamide (CAS 16091-26-2) is a chemical compound with the molecular formula C13H12N2O and a molecular weight of 212.25 g/mol. IUPAC name: N-(3-aminophenyl)benzamide. InChIKey: IRFCTHNJIWUUJZ-UHFFFAOYSA-N.
| Molecular formula | C13H12N2O |
|---|---|
| Molecular weight | 212.25 g/mol |
| IUPAC name | N-(3-aminophenyl)benzamide |
| InChIKey | IRFCTHNJIWUUJZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)NC2=CC=CC(=C2)N |
Computed by PubChem (NCBI)