CAS 1609290-12-1 appears in our catalog under these names: Rel-(1R,2R)-2-(3-fluoro-4-methoxyphenyl)cyclopropane-1-carboxylic acid, 97%, trans–2–(3–fluoro–4–methoxyphenyl)cyclopropane–1–carboxylic acid, rac-(1R,2R)-2-(3-fluoro-4-methoxyphenyl)cyclopropane-1-carboxylic acid, 97%, 97%. Offered by: AmBeed, GLPBio, Chemat. Available pack sizes: 5g, 1g, 500mg, 100mg, 250mg.
Trans-(1R,2R)-2-(3-fluoro-4-methoxyphenyl)cyclopropane-1-carboxylic acid (CAS 1609290-12-1) is a chemical compound with the molecular formula C11H11FO3 and a molecular weight of 210.20 g/mol. IUPAC name: trans-(1R,2R)-2-(3-fluoro-4-methoxyphenyl)cyclopropane-1-carboxylic acid. InChIKey: QTFOMBBFRHFKKN-JGVFFNPUSA-N.
| Molecular formula | C11H11FO3 |
|---|---|
| Molecular weight | 210.20 g/mol |
| IUPAC name | trans-(1R,2R)-2-(3-fluoro-4-methoxyphenyl)cyclopropane-1-carboxylic acid |
| InChIKey | QTFOMBBFRHFKKN-JGVFFNPUSA-N |
| SMILES | COC1=C(C=C(C=C1)[C@@H]2C[C@H]2C(=O)O)F |
Computed by PubChem (NCBI)