CAS 220352-90-9 appears in our catalog under these names: (1R,2R)-2-(3-Fluoro-4-methoxyphenyl)cyclopropane-1-carboxylic acid, 95%, (1R,2R)-2-(3-fluoro-4-methoxy-phenyl)cyclopropanecarboxylic acid, 97%, 97%. Offered by: AmBeed, Chemat. Available pack sizes: 1g, 100mg, 250mg, 500mg.
Trans-(1R,2R)-2-(3-fluoro-4-methoxyphenyl)cyclopropane-1-carboxylic acid (CAS 220352-90-9) is a chemical compound with the molecular formula C11H11FO3 and a molecular weight of 210.20 g/mol. IUPAC name: trans-(1R,2R)-2-(3-fluoro-4-methoxyphenyl)cyclopropane-1-carboxylic acid. InChIKey: QTFOMBBFRHFKKN-JGVFFNPUSA-N.
| Molecular formula | C11H11FO3 |
|---|---|
| Molecular weight | 210.20 g/mol |
| IUPAC name | trans-(1R,2R)-2-(3-fluoro-4-methoxyphenyl)cyclopropane-1-carboxylic acid |
| InChIKey | QTFOMBBFRHFKKN-JGVFFNPUSA-N |
| SMILES | COC1=C(C=C(C=C1)[C@@H]2C[C@H]2C(=O)O)F |
Computed by PubChem (NCBI)