CAS 1609396-20-4 appears in our catalog under these names: cis-Piperidine-3,5-diyldimethanol hydrochloride, 97%, ((3S,5R)-5-(Hydroxymethyl)piperidin-3-yl)methanol hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 0,5g, 50mg.
[(3R,5S)-5-(hydroxymethyl)piperidin-3-yl]methanol;hydrochloride (CAS 1609396-20-4) is a chemical compound with the molecular formula C7H16ClNO2 and a molecular weight of 181.66 g/mol. IUPAC name: [(3R,5S)-5-(hydroxymethyl)piperidin-3-yl]methanol;hydrochloride. InChIKey: OASRRWXKEIFOMR-UKMDXRBESA-N.
| Molecular formula | C7H16ClNO2 |
|---|---|
| Molecular weight | 181.66 g/mol |
| IUPAC name | [(3R,5S)-5-(hydroxymethyl)piperidin-3-yl]methanol;hydrochloride |
| InChIKey | OASRRWXKEIFOMR-UKMDXRBESA-N |
| SMILES | C1[C@H](CNC[C@H]1CO)CO.Cl |
Computed by PubChem (NCBI)