Products 1610732-22-3
CAS 1610732-22-3 appears in our catalog under these names: (1S,3S)-Cyclohexane-1,3-dicarboxylic acid, 95%, (1S,3S)-Cyclohexane-1,3-dicarboxylic acid, 97%, 97%, (1S,3S)-Cyclohexane-1,3-dicarboxylic acid, 97%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg, 500mg.
Trans-(1S,3S)-cyclohexane-1,3-dicarboxylic acid (CAS 1610732-22-3) is a chemical compound with the molecular formula C8H12O4 and a molecular weight of 172.18 g/mol. IUPAC name: trans-(1S,3S)-cyclohexane-1,3-dicarboxylic acid. InChIKey: XBZSBBLNHFMTEB-WDSKDSINSA-N.
| Molecular formula | C8H12O4 |
|---|---|
| Molecular weight | 172.18 g/mol |
| IUPAC name | trans-(1S,3S)-cyclohexane-1,3-dicarboxylic acid |
| InChIKey | XBZSBBLNHFMTEB-WDSKDSINSA-N |
| SMILES | C1C[C@@H](C[C@H](C1)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)