CAS 21917-23-7 is the registry number for (1R,3R)-Cyclohexane-1,3-dicarboxylic acid, 98%. Offered by: AmBeed. Available pack sizes: 1g.
Trans-(1R,3R)-cyclohexane-1,3-dicarboxylic acid (CAS 21917-23-7) is a chemical compound with the molecular formula C8H12O4 and a molecular weight of 172.18 g/mol. IUPAC name: trans-(1R,3R)-cyclohexane-1,3-dicarboxylic acid. InChIKey: XBZSBBLNHFMTEB-PHDIDXHHSA-N.
| Molecular formula | C8H12O4 |
|---|---|
| Molecular weight | 172.18 g/mol |
| IUPAC name | trans-(1R,3R)-cyclohexane-1,3-dicarboxylic acid |
| InChIKey | XBZSBBLNHFMTEB-PHDIDXHHSA-N |
| SMILES | C1C[C@H](C[C@@H](C1)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)