CAS 161711-27-9 is the registry number for (1R,2R)-2-(4-Fluorophenyl)cyclopropane-1-carboxylic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 1g.
Trans-(1R,2R)-2-(4-fluorophenyl)cyclopropane-1-carboxylic acid (CAS 161711-27-9) is a chemical compound with the molecular formula C10H9FO2 and a molecular weight of 180.17 g/mol. IUPAC name: trans-(1R,2R)-2-(4-fluorophenyl)cyclopropane-1-carboxylic acid. InChIKey: QJJWMUZHTDQZDW-DTWKUNHWSA-N.
| Molecular formula | C10H9FO2 |
|---|---|
| Molecular weight | 180.17 g/mol |
| IUPAC name | trans-(1R,2R)-2-(4-fluorophenyl)cyclopropane-1-carboxylic acid |
| InChIKey | QJJWMUZHTDQZDW-DTWKUNHWSA-N |
| SMILES | C1[C@H]([C@@H]1C(=O)O)C2=CC=C(C=C2)F |
Computed by PubChem (NCBI)