CAS 515179-19-8 appears in our catalog under these names: (1S,2S)–2–(4–Fluoro–phenyl)–cyclopropanecarboxylic acid, (1S,2S)-2-(4-Fluorophenyl)cyclopropanecarboxylic acid 95%, (1S,2S)-2-(4-Fluorophenyl)cyclopropanecarboxylic acid, 95%, 95%, (1S,2S)-2-(4-Fluorophenyl)cyclopropanecarboxylic acid, 95%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 50mg, 1g.
Trans-(1S,2S)-2-(4-fluorophenyl)cyclopropane-1-carboxylic acid (CAS 515179-19-8) is a chemical compound with the molecular formula C10H9FO2 and a molecular weight of 180.17 g/mol. IUPAC name: trans-(1S,2S)-2-(4-fluorophenyl)cyclopropane-1-carboxylic acid. InChIKey: QJJWMUZHTDQZDW-BDAKNGLRSA-N.
| Molecular formula | C10H9FO2 |
|---|---|
| Molecular weight | 180.17 g/mol |
| IUPAC name | trans-(1S,2S)-2-(4-fluorophenyl)cyclopropane-1-carboxylic acid |
| InChIKey | QJJWMUZHTDQZDW-BDAKNGLRSA-N |
| SMILES | C1[C@@H]([C@H]1C(=O)O)C2=CC=C(C=C2)F |
Computed by PubChem (NCBI)