CAS 950588-81-5 appears in our catalog under these names: rel-(1R,2S)-2-(4-Fluorophenyl)cyclopropane-1-carboxylic acid, 95%, cis-2-(4-fluorophenyl)cyclopropanecarboxylic acid, 97%, 97%. Offered by: AmBeed, Chemat. Available pack sizes: 250mg, 1g, 100mg, 500mg.
Cis-(1R,2S)-2-(4-fluorophenyl)cyclopropane-1-carboxylic acid (CAS 950588-81-5) is a chemical compound with the molecular formula C10H9FO2 and a molecular weight of 180.17 g/mol. IUPAC name: cis-(1R,2S)-2-(4-fluorophenyl)cyclopropane-1-carboxylic acid. InChIKey: QJJWMUZHTDQZDW-RKDXNWHRSA-N.
| Molecular formula | C10H9FO2 |
|---|---|
| Molecular weight | 180.17 g/mol |
| IUPAC name | cis-(1R,2S)-2-(4-fluorophenyl)cyclopropane-1-carboxylic acid |
| InChIKey | QJJWMUZHTDQZDW-RKDXNWHRSA-N |
| SMILES | C1[C@@H]([C@@H]1C(=O)O)C2=CC=C(C=C2)F |
Computed by PubChem (NCBI)