CAS 161712-75-0 appears in our catalog under these names: 3,4-Difluorohydrocinnamic acid, 98%, 3,4–Difluorohydrocinnamic acid, 3-(3,4-Difluorophenyl)propionic acid, 98% , 3-(3,4-Difluorophenyl)propanoic acid 98%, 3-(3,4-Difluorophenyl)propanoic acid, 96%, 96%. Offered by: Combi-blocks, GLPBio, Thermo Scientific (Alfa Aesar), Ambeed, Chemat. Available pack sizes: 10g, 25g, 100g, 1g, 5g, 250mg.
3-(3,4-difluorophenyl)propanoic acid (CAS 161712-75-0) is a chemical compound with the molecular formula C9H8F2O2 and a molecular weight of 186.15 g/mol. IUPAC name: 3-(3,4-difluorophenyl)propanoic acid. InChIKey: UOZIYCHJMUNLIG-UHFFFAOYSA-N.
| Molecular formula | C9H8F2O2 |
|---|---|
| Molecular weight | 186.15 g/mol |
| IUPAC name | 3-(3,4-difluorophenyl)propanoic acid |
| InChIKey | UOZIYCHJMUNLIG-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1CCC(=O)O)F)F |
Computed by PubChem (NCBI)