CAS 161771-75-1 appears in our catalog under these names: Pidotimod Impurity X, Pidotimod Impurity 7, Pidotimod diketopiperazine-6-propanoic acid. Offered by: Chemat Brand, Hubei YoungXin, Biosynth. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
3-(5,8-dioxo-3,6,7,8a-tetrahydro-1H-[1,3]thiazolo[3,4-a]pyrazin-6-yl)propanoic acid (CAS 161771-75-1) is a chemical compound with the molecular formula C9H12N2O4S and a molecular weight of 244.27 g/mol. IUPAC name: 3-(5,8-dioxo-3,6,7,8a-tetrahydro-1H-[1,3]thiazolo[3,4-a]pyrazin-6-yl)propanoic acid. InChIKey: SIHJCGBZTATYLB-UHFFFAOYSA-N.
| Molecular formula | C9H12N2O4S |
|---|---|
| Molecular weight | 244.27 g/mol |
| IUPAC name | 3-(5,8-dioxo-3,6,7,8a-tetrahydro-1H-[1,3]thiazolo[3,4-a]pyrazin-6-yl)propanoic acid |
| InChIKey | SIHJCGBZTATYLB-UHFFFAOYSA-N |
| SMILES | C1C2C(=O)NC(C(=O)N2CS1)CCC(=O)O |
Computed by PubChem (NCBI)