Products 2165766-24-3
CAS 2165766-24-3 appears in our catalog under these names: Pidotimod Impurity 37, (6S,8aR)-Hexahydro-5,8-dioxo-3H-thiazolo(3,4-a)pyrazine-6-propanoic Acid, >95% (HPLC). Offered by: Chemat Brand, TRC. Available pack sizes: on request, 25mg, 50mg.
3-[(6S)-5,8-dioxo-3,6,7,8a-tetrahydro-1H-[1,3]thiazolo[3,4-a]pyrazin-6-yl]propanoic acid (CAS 2165766-24-3) is a chemical compound with the molecular formula C9H12N2O4S and a molecular weight of 244.27 g/mol. IUPAC name: 3-[(6S)-5,8-dioxo-3,6,7,8a-tetrahydro-1H-[1,3]thiazolo[3,4-a]pyrazin-6-yl]propanoic acid. InChIKey: SIHJCGBZTATYLB-ZBHICJROSA-N.
| Molecular formula | C9H12N2O4S |
|---|---|
| Molecular weight | 244.27 g/mol |
| IUPAC name | 3-[(6S)-5,8-dioxo-3,6,7,8a-tetrahydro-1H-[1,3]thiazolo[3,4-a]pyrazin-6-yl]propanoic acid |
| InChIKey | SIHJCGBZTATYLB-ZBHICJROSA-N |
| SMILES | C1C2C(=O)N[C@H](C(=O)N2CS1)CCC(=O)O |
Computed by PubChem (NCBI)