CAS 1619980-13-0 appears in our catalog under these names: (2,4-difluoro-3-methylphenyl)boronic acid, (2,4-Difluoro-3-methylphenyl)boronic acid, 98%, 98%, (2,4-Difluoro-3-methylphenyl)boronic acid, 98%. Offered by: Biosynth, Chemat, Fluorochem. Available pack sizes: 1g, 10g, 100mg, 250mg, 5g.
(2,4-difluoro-3-methylphenyl)boronic acid (CAS 1619980-13-0) is a chemical compound with the molecular formula C7H7BF2O2 and a molecular weight of 171.94 g/mol. IUPAC name: (2,4-difluoro-3-methylphenyl)boronic acid. InChIKey: UEVQAPSBQZFLML-UHFFFAOYSA-N.
| Molecular formula | C7H7BF2O2 |
|---|---|
| Molecular weight | 171.94 g/mol |
| IUPAC name | (2,4-difluoro-3-methylphenyl)boronic acid |
| InChIKey | UEVQAPSBQZFLML-UHFFFAOYSA-N |
| SMILES | B(C1=C(C(=C(C=C1)F)C)F)(O)O |
Computed by PubChem (NCBI)