CAS 16204-48-1 appears in our catalog under these names: rac-(1S,3S)-3-Phenylcyclobutane-1-carboxylic acid, cis-3-Phenylcyclobutanecarboxylic Acid, 97%, 97%. Offered by: Biosynth, Chemat. Available pack sizes: 50mg, 0,5g, 100mg, 250mg, 500mg.
3-phenylcyclobutane-1-carboxylic acid (CAS 16204-48-1) is a chemical compound with the molecular formula C11H12O2 and a molecular weight of 176.21 g/mol. IUPAC name: 3-phenylcyclobutane-1-carboxylic acid. InChIKey: KOSJHQBPJQYNTB-UHFFFAOYSA-N.
| Molecular formula | C11H12O2 |
|---|---|
| Molecular weight | 176.21 g/mol |
| IUPAC name | 3-phenylcyclobutane-1-carboxylic acid |
| InChIKey | KOSJHQBPJQYNTB-UHFFFAOYSA-N |
| SMILES | C1C(CC1C(=O)O)C2=CC=CC=C2 |
Computed by PubChem (NCBI)