CAS 66016-28-2 appears in our catalog under these names: 3-Phenylcyclobutane-1-carboxylic acid, 97%, 3–Phenylcyclobutanecarboxylic acid, 3-phenylcyclobutanecarboxylic acid, 3-Phenylcyclobutane-1-carboxylic acid 97%, Cyclobutanecarboxylic acid, 3-phenyl-, 97%, 97%. Offered by: Combi-blocks, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 5g, 10g, 25g, 250mg, 1g, 2,5g, 100mg, 500mg.
3-phenylcyclobutane-1-carboxylic acid (CAS 66016-28-2) is a chemical compound with the molecular formula C11H12O2 and a molecular weight of 176.21 g/mol. IUPAC name: 3-phenylcyclobutane-1-carboxylic acid. InChIKey: KOSJHQBPJQYNTB-UHFFFAOYSA-N.
| Molecular formula | C11H12O2 |
|---|---|
| Molecular weight | 176.21 g/mol |
| IUPAC name | 3-phenylcyclobutane-1-carboxylic acid |
| InChIKey | KOSJHQBPJQYNTB-UHFFFAOYSA-N |
| SMILES | C1C(CC1C(=O)O)C2=CC=CC=C2 |
Computed by PubChem (NCBI)