CAS 1620821-59-1 appears in our catalog under these names: Methyl 4-aminocubane-1-carboxylate hydrochloride, 95-<97%, Methyl (1s,2R,3r,8S)-4-Aminocubane-1-carboxylate Hydrochloride, >95.0%(HPLC)(qNMR), METHYL 8-AMINOCUBANE-1-CARBOXYLATE HYDROCHLORIDE, 97%, 97%. Offered by: Hoffman Fine Chemicals, TCI, Chemat. Available pack sizes: 500mg, 1g, 2,5g, 5g, 10g, 100mg, 250mg.
Methyl 4-aminocubane-1-carboxylate;hydrochloride (CAS 1620821-59-1) is a chemical compound with the molecular formula C10H12ClNO2 and a molecular weight of 213.66 g/mol. IUPAC name: methyl 4-aminocubane-1-carboxylate;hydrochloride. InChIKey: AMZGEDRFHBTSQT-UHFFFAOYSA-N.
| Molecular formula | C10H12ClNO2 |
|---|---|
| Molecular weight | 213.66 g/mol |
| IUPAC name | methyl 4-aminocubane-1-carboxylate;hydrochloride |
| InChIKey | AMZGEDRFHBTSQT-UHFFFAOYSA-N |
| SMILES | COC(=O)C12C3C4C1C5C2C3C45N.Cl |
Computed by PubChem (NCBI)