CAS 1624-54-0 appears in our catalog under these names: 2-((1E)-((2-Hydroxyphenyl)imino)methyl)phenol, 90%, (E)-2-((2-hydroxybenzylidene)amino)phenol, 98%. Offered by: AmBeed, Fluorochem. Available pack sizes: 25g, 1g, 5g.
2-[(2-hydroxyphenyl)iminomethyl]phenol (CAS 1624-54-0) is a chemical compound with the molecular formula C13H11NO2 and a molecular weight of 213.23 g/mol. IUPAC name: 2-[(2-hydroxyphenyl)iminomethyl]phenol. InChIKey: CHBGIQHEGBKNGA-UHFFFAOYSA-N.
| Molecular formula | C13H11NO2 |
|---|---|
| Molecular weight | 213.23 g/mol |
| IUPAC name | 2-[(2-hydroxyphenyl)iminomethyl]phenol |
| InChIKey | CHBGIQHEGBKNGA-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C=NC2=CC=CC=C2O)O |
Computed by PubChem (NCBI)