CAS 16261-80-6 appears in our catalog under these names: 4-(2-Hydroxyhexafluoroisopropyl)benzoic acid, 95%, 4-(2-Hydroxyhexafluoroisopropyl)benzoic acid, 97% . Offered by: Combi-blocks, Thermo Scientific (Alfa Aesar). Available pack sizes: 250mg, 5g, 1g.
4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)benzoic acid (CAS 16261-80-6) is a chemical compound with the molecular formula C10H6F6O3 and a molecular weight of 288.14 g/mol. IUPAC name: 4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)benzoic acid. InChIKey: DLJNNINHDYILFL-UHFFFAOYSA-N.
| Molecular formula | C10H6F6O3 |
|---|---|
| Molecular weight | 288.14 g/mol |
| IUPAC name | 4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)benzoic acid |
| InChIKey | DLJNNINHDYILFL-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)O)C(C(F)(F)F)(C(F)(F)F)O |
Computed by PubChem (NCBI)