CAS 801303-36-6 is the registry number for 4-(2,2,2-Trifluoro-ethoxy)-3-trifluoromethyl-benzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
4-(2,2,2-trifluoroethoxy)-3-(trifluoromethyl)benzoic acid (CAS 801303-36-6) is a chemical compound with the molecular formula C10H6F6O3 and a molecular weight of 288.14 g/mol. IUPAC name: 4-(2,2,2-trifluoroethoxy)-3-(trifluoromethyl)benzoic acid. InChIKey: WMMFIPWVTODBKX-UHFFFAOYSA-N.
| Molecular formula | C10H6F6O3 |
|---|---|
| Molecular weight | 288.14 g/mol |
| IUPAC name | 4-(2,2,2-trifluoroethoxy)-3-(trifluoromethyl)benzoic acid |
| InChIKey | WMMFIPWVTODBKX-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(=O)O)C(F)(F)F)OCC(F)(F)F |
Computed by PubChem (NCBI)