Products 801303-36-6

CAS 801303-36-6 is the registry number for 4-(2,2,2-Trifluoro-ethoxy)-3-trifluoromethyl-benzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

4-(2,2,2-trifluoroethoxy)-3-(trifluoromethyl)benzoic acid (CAS 801303-36-6) is a chemical compound with the molecular formula C10H6F6O3 and a molecular weight of 288.14 g/mol. IUPAC name: 4-(2,2,2-trifluoroethoxy)-3-(trifluoromethyl)benzoic acid. InChIKey: WMMFIPWVTODBKX-UHFFFAOYSA-N.

Identity
Molecular formulaC10H6F6O3
Molecular weight288.14 g/mol
IUPAC name4-(2,2,2-trifluoroethoxy)-3-(trifluoromethyl)benzoic acid
InChIKeyWMMFIPWVTODBKX-UHFFFAOYSA-N
SMILESC1=CC(=C(C=C1C(=O)O)C(F)(F)F)OCC(F)(F)F

Computed by PubChem (NCBI)