CAS 180134-15-0 appears in our catalog under these names: 2-Methoxy-4,6-bis(trifluoromethyl)benzoic acid, 95%, 2-Methoxy-4,6-bis(trifluoromethyl)benzoic acid, ≥97%, ≥97%. Offered by: Combi-blocks, Chemat. Available pack sizes: 5g, 1g, 250mg.
2-methoxy-4,6-bis(trifluoromethyl)benzoic acid (CAS 180134-15-0) is a chemical compound with the molecular formula C10H6F6O3 and a molecular weight of 288.14 g/mol. IUPAC name: 2-methoxy-4,6-bis(trifluoromethyl)benzoic acid. InChIKey: IIWWKGJYKXFWRG-UHFFFAOYSA-N.
| Molecular formula | C10H6F6O3 |
|---|---|
| Molecular weight | 288.14 g/mol |
| IUPAC name | 2-methoxy-4,6-bis(trifluoromethyl)benzoic acid |
| InChIKey | IIWWKGJYKXFWRG-UHFFFAOYSA-N |
| SMILES | COC1=CC(=CC(=C1C(=O)O)C(F)(F)F)C(F)(F)F |
Computed by PubChem (NCBI)