CAS 197015-74-0 is the registry number for 3,5-Bis(trifluoromethyl)-2-methoxybenzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 250mg.
2-methoxy-3,5-bis(trifluoromethyl)benzoic acid (CAS 197015-74-0) is a chemical compound with the molecular formula C10H6F6O3 and a molecular weight of 288.14 g/mol. IUPAC name: 2-methoxy-3,5-bis(trifluoromethyl)benzoic acid. InChIKey: QXKHBZGPGPNUGZ-UHFFFAOYSA-N.
| Molecular formula | C10H6F6O3 |
|---|---|
| Molecular weight | 288.14 g/mol |
| IUPAC name | 2-methoxy-3,5-bis(trifluoromethyl)benzoic acid |
| InChIKey | QXKHBZGPGPNUGZ-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1C(F)(F)F)C(F)(F)F)C(=O)O |
Computed by PubChem (NCBI)