Products 228107-82-2
CAS 228107-82-2 appears in our catalog under these names: 2-(3,5-Bis(trifluoromethyl)phenyl)-2-hydroxyacetic acid, 95%, 95%, 3,5-Bis(trifluoromethyl)mandelic acid, 96%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 500mg, 5g.
2-[3,5-bis(trifluoromethyl)phenyl]-2-hydroxyacetic acid (CAS 228107-82-2) is a chemical compound with the molecular formula C10H6F6O3 and a molecular weight of 288.14 g/mol. IUPAC name: 2-[3,5-bis(trifluoromethyl)phenyl]-2-hydroxyacetic acid. InChIKey: ZVACZNUZAKRYHT-UHFFFAOYSA-N.
| Molecular formula | C10H6F6O3 |
|---|---|
| Molecular weight | 288.14 g/mol |
| IUPAC name | 2-[3,5-bis(trifluoromethyl)phenyl]-2-hydroxyacetic acid |
| InChIKey | ZVACZNUZAKRYHT-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1C(F)(F)F)C(F)(F)F)C(C(=O)O)O |
Computed by PubChem (NCBI)