CAS 871944-19-3 is the registry number for 2-(2,4-Bis(trifluoromethyl)phenyl)-2-hydroxyacetic acid, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
2-[2,4-bis(trifluoromethyl)phenyl]-2-hydroxyacetic acid (CAS 871944-19-3) is a chemical compound with the molecular formula C10H6F6O3 and a molecular weight of 288.14 g/mol. IUPAC name: 2-[2,4-bis(trifluoromethyl)phenyl]-2-hydroxyacetic acid. InChIKey: KFPFBJBTNVPDGW-UHFFFAOYSA-N.
| Molecular formula | C10H6F6O3 |
|---|---|
| Molecular weight | 288.14 g/mol |
| IUPAC name | 2-[2,4-bis(trifluoromethyl)phenyl]-2-hydroxyacetic acid |
| InChIKey | KFPFBJBTNVPDGW-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(F)(F)F)C(F)(F)F)C(C(=O)O)O |
Computed by PubChem (NCBI)