Products 2375008-65-2
CAS 2375008-65-2 is the registry number for 3-(2,2,2-Trifluoroethoxy)-5-(trifluoromethyl)benzoic acid. Offered by: Biosynth. Available pack sizes: 0,05g, 0,5g.
3-(2,2,2-trifluoroethoxy)-5-(trifluoromethyl)benzoic acid (CAS 2375008-65-2) is a chemical compound with the molecular formula C10H6F6O3 and a molecular weight of 288.14 g/mol. IUPAC name: 3-(2,2,2-trifluoroethoxy)-5-(trifluoromethyl)benzoic acid. InChIKey: IOVIMKLWUBCGSL-UHFFFAOYSA-N.
| Molecular formula | C10H6F6O3 |
|---|---|
| Molecular weight | 288.14 g/mol |
| IUPAC name | 3-(2,2,2-trifluoroethoxy)-5-(trifluoromethyl)benzoic acid |
| InChIKey | IOVIMKLWUBCGSL-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1C(F)(F)F)OCC(F)(F)F)C(=O)O |
Computed by PubChem (NCBI)