Products 1628431-65-1
CAS 1628431-65-1 appears in our catalog under these names: Methyl 4-amino-2-cyanobenzoate, 97%, Methyl 4–amino–2–cyanobenzoate, Methyl 4-amino-2-cyanobenzoate, Methyl 4-amino-2-cyanobenzoate 97%, Methyl 4-Amino-2-Cyanobenzoate, 97%, 97%. Offered by: Combi-blocks, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 1g, 250mg, 25g, 5g, 10g, 100mg, 2,5g, 500mg.
Methyl 4-amino-2-cyanobenzoate (CAS 1628431-65-1) is a chemical compound with the molecular formula C9H8N2O2 and a molecular weight of 176.17 g/mol. IUPAC name: methyl 4-amino-2-cyanobenzoate. InChIKey: NUXNORSXWRMRPH-UHFFFAOYSA-N.
| Molecular formula | C9H8N2O2 |
|---|---|
| Molecular weight | 176.17 g/mol |
| IUPAC name | methyl 4-amino-2-cyanobenzoate |
| InChIKey | NUXNORSXWRMRPH-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=C(C=C1)N)C#N |
Computed by PubChem (NCBI)