Products 1628684-10-5
CAS 1628684-10-5 appears in our catalog under these names: (4-Chloro-2-fluoro-6-methoxyphenyl)boronic acid, 97%, 97%, (4-Chloro-2-fluoro-6-methoxyphenyl)boronic acid, 97%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g.
(4-chloro-2-fluoro-6-methoxyphenyl)boronic acid (CAS 1628684-10-5) is a chemical compound with the molecular formula C7H7BClFO3 and a molecular weight of 204.39 g/mol. IUPAC name: (4-chloro-2-fluoro-6-methoxyphenyl)boronic acid. InChIKey: GEHVMMGKDMOFQJ-UHFFFAOYSA-N.
| Molecular formula | C7H7BClFO3 |
|---|---|
| Molecular weight | 204.39 g/mol |
| IUPAC name | (4-chloro-2-fluoro-6-methoxyphenyl)boronic acid |
| InChIKey | GEHVMMGKDMOFQJ-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1F)Cl)OC)(O)O |
Computed by PubChem (NCBI)