CAS 163298-84-8 appears in our catalog under these names: 3-(1,3-Thiazol-2-yloxy)phenol, 95%, 3-(1,3-Thiazol-2-yloxy)phenol. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 5g, 0,5g, 50mg.
3-(1,3-thiazol-2-yloxy)phenol (CAS 163298-84-8) is a chemical compound with the molecular formula C9H7NO2S and a molecular weight of 193.22 g/mol. IUPAC name: 3-(1,3-thiazol-2-yloxy)phenol. InChIKey: ZPFLNBQPKNZVGY-UHFFFAOYSA-N.
| Molecular formula | C9H7NO2S |
|---|---|
| Molecular weight | 193.22 g/mol |
| IUPAC name | 3-(1,3-thiazol-2-yloxy)phenol |
| InChIKey | ZPFLNBQPKNZVGY-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)OC2=NC=CS2)O |
Computed by PubChem (NCBI)