Products 163671-09-8
CAS 163671-09-8 is the registry number for N-Fmoc-3R-hydroxypyrrolidine-5S-methanol. Offered by: MedChemExpress. Available pack sizes: Get quote.
9H-fluoren-9-ylmethyl (2R,4R)-4-hydroxy-2-(hydroxymethyl)pyrrolidine-1-carboxylate (CAS 163671-09-8) is a chemical compound with the molecular formula C20H21NO4 and a molecular weight of 339.4 g/mol. IUPAC name: 9H-fluoren-9-ylmethyl (2R,4R)-4-hydroxy-2-(hydroxymethyl)pyrrolidine-1-carboxylate. InChIKey: SCXXARDQPGZAJU-ZIAGYGMSSA-N.
| Molecular formula | C20H21NO4 |
|---|---|
| Molecular weight | 339.4 g/mol |
| IUPAC name | 9H-fluoren-9-ylmethyl (2R,4R)-4-hydroxy-2-(hydroxymethyl)pyrrolidine-1-carboxylate |
| InChIKey | SCXXARDQPGZAJU-ZIAGYGMSSA-N |
| SMILES | C1[C@H](CN([C@H]1CO)C(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24)O |
Computed by PubChem (NCBI)