Products 1638761-60-0
CAS 1638761-60-0 appears in our catalog under these names: 1-methyl-1H-pyrrolo[2,3-b]pyridine-3-sulfonyl chloride, 97%, 1-Methyl-1H-pyrrolo[2,3-b]pyridine-3-sulfonyl chloride, 95%. Offered by: Ambeed, Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg.
1-methylpyrrolo[2,3-b]pyridine-3-sulfonyl chloride (CAS 1638761-60-0) is a chemical compound with the molecular formula C8H7ClN2O2S and a molecular weight of 230.67 g/mol. IUPAC name: 1-methylpyrrolo[2,3-b]pyridine-3-sulfonyl chloride. InChIKey: AMNDZKQXDLDCEN-UHFFFAOYSA-N.
| Molecular formula | C8H7ClN2O2S |
|---|---|
| Molecular weight | 230.67 g/mol |
| IUPAC name | 1-methylpyrrolo[2,3-b]pyridine-3-sulfonyl chloride |
| InChIKey | AMNDZKQXDLDCEN-UHFFFAOYSA-N |
| SMILES | CN1C=C(C2=C1N=CC=C2)S(=O)(=O)Cl |
Computed by PubChem (NCBI)