Products 1638785-15-5
CAS 1638785-15-5 is the registry number for 4-(2-Chloroacetyl)-N-methoxy-N,alpha,alpha-trimethyl-benzeneacetamide. Offered by: TRC. Available pack sizes: 50mg.
2-[4-(2-chloroacetyl)phenyl]-N-methoxy-N,2-dimethylpropanamide (CAS 1638785-15-5) is a chemical compound with the molecular formula C14H18ClNO3 and a molecular weight of 283.75 g/mol. IUPAC name: 2-[4-(2-chloroacetyl)phenyl]-N-methoxy-N,2-dimethylpropanamide. InChIKey: ZLIZIJGDTZSDLY-UHFFFAOYSA-N.
| Molecular formula | C14H18ClNO3 |
|---|---|
| Molecular weight | 283.75 g/mol |
| IUPAC name | 2-[4-(2-chloroacetyl)phenyl]-N-methoxy-N,2-dimethylpropanamide |
| InChIKey | ZLIZIJGDTZSDLY-UHFFFAOYSA-N |
| SMILES | CC(C)(C1=CC=C(C=C1)C(=O)CCl)C(=O)N(C)OC |
Computed by PubChem (NCBI)