CAS 24698-57-5 appears in our catalog under these names: 3,4–Methylenedioxy–α–Pyrrolidinopropiophenone (hydrochloride), 3',4'-Methylenedioxy-alpha-pyrrolidinopropiophenone Hydrochloride, MDPPP HCl (3,4-Methylenedioxy-alpha-pyrrolidinopropiophenone Hydrochloride), MDPPP HCl (3,4-Methylenedioxy-alpha-pyrrolidinopropiophenone Hydrochloride) 1.0 mg/ml in Methanol (as free base), MDPPP.HCl. Offered by: GLPBio, TRC, LoGiCal, Lipomed. Available pack sizes: 5mg, 250mg, 10mg, 1ml, 50mg, 100mg.
1-(1,3-benzodioxol-5-yl)-2-pyrrolidin-1-ylpropan-1-one;hydrochloride (CAS 24698-57-5) is a chemical compound with the molecular formula C14H18ClNO3 and a molecular weight of 283.75 g/mol. IUPAC name: 1-(1,3-benzodioxol-5-yl)-2-pyrrolidin-1-ylpropan-1-one;hydrochloride. InChIKey: UILIFCMRCTZRPJ-UHFFFAOYSA-N.
| Molecular formula | C14H18ClNO3 |
|---|---|
| Molecular weight | 283.75 g/mol |
| IUPAC name | 1-(1,3-benzodioxol-5-yl)-2-pyrrolidin-1-ylpropan-1-one;hydrochloride |
| InChIKey | UILIFCMRCTZRPJ-UHFFFAOYSA-N |
| SMILES | CC(C(=O)C1=CC2=C(C=C1)OCO2)N3CCCC3.Cl |
Computed by PubChem (NCBI)