Products 891-72-5

CAS 891-72-5 is the registry number for Ethyl 1-benzyl-4-oxopyrrolidine-3-carboxylate hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.

Structural formula: {0} (CAS {1})

Ethyl 1-benzyl-4-oxopyrrolidine-3-carboxylate;hydrochloride (CAS 891-72-5) is a chemical compound with the molecular formula C14H18ClNO3 and a molecular weight of 283.75 g/mol. IUPAC name: ethyl 1-benzyl-4-oxopyrrolidine-3-carboxylate;hydrochloride. InChIKey: NOMYMHWUMFMDLF-UHFFFAOYSA-N.

Identity
Molecular formulaC14H18ClNO3
Molecular weight283.75 g/mol
IUPAC nameethyl 1-benzyl-4-oxopyrrolidine-3-carboxylate;hydrochloride
InChIKeyNOMYMHWUMFMDLF-UHFFFAOYSA-N
SMILESCCOC(=O)C1CN(CC1=O)CC2=CC=CC=C2.Cl

Computed by PubChem (NCBI)