Products 1999972-72-3
CAS 1999972-72-3 is the registry number for (1-(3-Chlorophenyl)-1-oxopropan-2-yl)carbamic Acid tert-Butyl Ester. Offered by: TRC. Available pack sizes: 100mg, 250mg, 500mg.
Tert-butyl N-[1-(3-chlorophenyl)-1-oxopropan-2-yl]carbamate (CAS 1999972-72-3) is a chemical compound with the molecular formula C14H18ClNO3 and a molecular weight of 283.75 g/mol. IUPAC name: tert-butyl N-[1-(3-chlorophenyl)-1-oxopropan-2-yl]carbamate. InChIKey: AKLLUBLAMWPSFJ-UHFFFAOYSA-N.
| Molecular formula | C14H18ClNO3 |
|---|---|
| Molecular weight | 283.75 g/mol |
| IUPAC name | tert-butyl N-[1-(3-chlorophenyl)-1-oxopropan-2-yl]carbamate |
| InChIKey | AKLLUBLAMWPSFJ-UHFFFAOYSA-N |
| SMILES | CC(C(=O)C1=CC(=CC=C1)Cl)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)