CAS 900137-36-2 appears in our catalog under these names: 1-(Chloroacetyl)-2-(2,5-dimethoxyphenyl)pyrrolidine, 95%, RNF114 ligand 1, 98%, RNF114 ligand 1, RNF114 ligand 1, 95.0%. Offered by: Combi-blocks, AmBeed, GLPBio, MedChemExpress. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 10mg, 5mg, 10 mg.
2-chloro-1-[2-(2,5-dimethoxyphenyl)pyrrolidin-1-yl]ethanone (CAS 900137-36-2) is a chemical compound with the molecular formula C14H18ClNO3 and a molecular weight of 283.75 g/mol. IUPAC name: 2-chloro-1-[2-(2,5-dimethoxyphenyl)pyrrolidin-1-yl]ethanone. InChIKey: RZXUCAQMZIQIRL-UHFFFAOYSA-N.
| Molecular formula | C14H18ClNO3 |
|---|---|
| Molecular weight | 283.75 g/mol |
| IUPAC name | 2-chloro-1-[2-(2,5-dimethoxyphenyl)pyrrolidin-1-yl]ethanone |
| InChIKey | RZXUCAQMZIQIRL-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1)OC)C2CCCN2C(=O)CCl |
Computed by PubChem (NCBI)