Products 38725-95-0
CAS 38725-95-0 is the registry number for Diethatyl. Offered by: TRC, Biosynth. Available pack sizes: 250mg, 10mg, 5mg, 25mg, 50mg.
2-(N-(2-chloroacetyl)-2,6-diethylanilino)acetic acid (CAS 38725-95-0) is a chemical compound with the molecular formula C14H18ClNO3 and a molecular weight of 283.75 g/mol. IUPAC name: 2-(N-(2-chloroacetyl)-2,6-diethylanilino)acetic acid. InChIKey: ISERORSDFSDMDV-UHFFFAOYSA-N.
| Molecular formula | C14H18ClNO3 |
|---|---|
| Molecular weight | 283.75 g/mol |
| IUPAC name | 2-(N-(2-chloroacetyl)-2,6-diethylanilino)acetic acid |
| InChIKey | ISERORSDFSDMDV-UHFFFAOYSA-N |
| SMILES | CCC1=C(C(=CC=C1)CC)N(CC(=O)O)C(=O)CCl |
Computed by PubChem (NCBI)
Synonyms:
Diethatyl, Diethatyl [ANSI:BSI:ISO], N-(Chloroacetyl)-N-(2,6-diethylphenyl)glycine, DIETHATYL [ISO], Glycine, N-(chloroacetyl)-N-(2,6-diethylphenyl)-, Diethatyl (ANSI:BSI:ISO), Glycine, N-(chloroacetyl)-N-(2,6-diethylphenyl)-(9CI), 2-(N-(2-chloroacetyl)-2,6-diethylanilino)acetic acid, Glycine, N-(2-chloroacetyl)-N-(2,6-diethylphenyl)-