Products 2891827-46-4
CAS 2891827-46-4 is the registry number for tert-Butyl 5-chloro-7-hydroxy-3,4-dihydroisoquinoline-2(1H)-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl 5-chloro-7-hydroxy-3,4-dihydro-1H-isoquinoline-2-carboxylate (CAS 2891827-46-4) is a chemical compound with the molecular formula C14H18ClNO3 and a molecular weight of 283.75 g/mol. IUPAC name: tert-butyl 5-chloro-7-hydroxy-3,4-dihydro-1H-isoquinoline-2-carboxylate. InChIKey: FGLXAFYZVSRNOS-UHFFFAOYSA-N.
| Molecular formula | C14H18ClNO3 |
|---|---|
| Molecular weight | 283.75 g/mol |
| IUPAC name | tert-butyl 5-chloro-7-hydroxy-3,4-dihydro-1H-isoquinoline-2-carboxylate |
| InChIKey | FGLXAFYZVSRNOS-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC2=C(C1)C=C(C=C2Cl)O |
Computed by PubChem (NCBI)