Products 1643570-23-3
CAS 1643570-23-3 appears in our catalog under these names: (R)–Elsubrutinib, (R)-4-(1-Acryloylpiperidin-3-yl)-1H-indole-7-carboxamide, 95%, 95%, (R)-Elsubrutinib, 98.0%. Offered by: GLPBio, Chemat, MedChemExpress. Available pack sizes: 10mg, 5mg, 1 mg, 10mM/1mL, 50 mg, 5 mg, 25 mg, 100 mg.
4-[(3R)-1-prop-2-enoylpiperidin-3-yl]-1H-indole-7-carboxamide (CAS 1643570-23-3) is a chemical compound with the molecular formula C17H19N3O2 and a molecular weight of 297.35 g/mol. IUPAC name: 4-[(3R)-1-prop-2-enoylpiperidin-3-yl]-1H-indole-7-carboxamide. InChIKey: UNHZLHSLZZWMNP-NSHDSACASA-N.
| Molecular formula | C17H19N3O2 |
|---|---|
| Molecular weight | 297.35 g/mol |
| IUPAC name | 4-[(3R)-1-prop-2-enoylpiperidin-3-yl]-1H-indole-7-carboxamide |
| InChIKey | UNHZLHSLZZWMNP-NSHDSACASA-N |
| SMILES | C=CC(=O)N1CCC[C@@H](C1)C2=C3C=CNC3=C(C=C2)C(=O)N |
Computed by PubChem (NCBI)