Products 1643586-52-0
CAS 1643586-52-0 appears in our catalog under these names: 5–(1H–Imidazol–1–yl)isophthalic acid, 5-(1H-Imidazol-1-yl)isophthalic acid, 98%. Offered by: GLPBio, Ambeed, BLDpharm, Fluorochem, Chemat. Available pack sizes: 1g, 100mg, 250mg, 5g.
5-imidazol-1-ylbenzene-1,3-dicarboxylic acid (CAS 1643586-52-0) is a chemical compound with the molecular formula C11H8N2O4 and a molecular weight of 232.19 g/mol. IUPAC name: 5-imidazol-1-ylbenzene-1,3-dicarboxylic acid. InChIKey: ADZVGTMYBJBONV-UHFFFAOYSA-N.
| Molecular formula | C11H8N2O4 |
|---|---|
| Molecular weight | 232.19 g/mol |
| IUPAC name | 5-imidazol-1-ylbenzene-1,3-dicarboxylic acid |
| InChIKey | ADZVGTMYBJBONV-UHFFFAOYSA-N |
| SMILES | C1=CN(C=N1)C2=CC(=CC(=C2)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)