CAS 1649471-55-5 appears in our catalog under these names: Methyl furo(3,2-b)pyridine-6-carboxylate, 98+%, Methyl Furo(3,2-B)Pyridine-6-Carboxylate. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
Methyl furo[3,2-b]pyridine-6-carboxylate (CAS 1649471-55-5) is a chemical compound with the molecular formula C9H7NO3 and a molecular weight of 177.16 g/mol. IUPAC name: methyl furo[3,2-b]pyridine-6-carboxylate. InChIKey: BZEFGEFKSGSJPY-UHFFFAOYSA-N.
| Molecular formula | C9H7NO3 |
|---|---|
| Molecular weight | 177.16 g/mol |
| IUPAC name | methyl furo[3,2-b]pyridine-6-carboxylate |
| InChIKey | BZEFGEFKSGSJPY-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC2=C(C=CO2)N=C1 |
Computed by PubChem (NCBI)