CAS 16513-67-0 appears in our catalog under these names: 2-Hydroxy-5-nitroindane, 95%, 5-Nitro-2,3-dihydro-1H-inden-2-ol, 95+%, 5–Nitro–2,3–dihydro–1H–inden–2–ol. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 5g, 1g, 25g, 250mg, 100mg.
5-nitro-2,3-dihydro-1H-inden-2-ol (CAS 16513-67-0) is a chemical compound with the molecular formula C9H9NO3 and a molecular weight of 179.17 g/mol. IUPAC name: 5-nitro-2,3-dihydro-1H-inden-2-ol. InChIKey: VAPGHIYRAUSHOH-UHFFFAOYSA-N.
| Molecular formula | C9H9NO3 |
|---|---|
| Molecular weight | 179.17 g/mol |
| IUPAC name | 5-nitro-2,3-dihydro-1H-inden-2-ol |
| InChIKey | VAPGHIYRAUSHOH-UHFFFAOYSA-N |
| SMILES | C1C(CC2=C1C=CC(=C2)[N+](=O)[O-])O |
Computed by PubChem (NCBI)