CAS 165250-68-0 appears in our catalog under these names: 4-Methyl-5-nitroindoline, 95%, 4-Methyl-5-nitroindoline 97%. Offered by: Combi-blocks, Ambeed. Available pack sizes: 250mg, 5g, 1g, 100mg.
4-methyl-5-nitro-2,3-dihydro-1H-indole (CAS 165250-68-0) is a chemical compound with the molecular formula C9H10N2O2 and a molecular weight of 178.19 g/mol. IUPAC name: 4-methyl-5-nitro-2,3-dihydro-1H-indole. InChIKey: XZXMLIIFZFXIHW-UHFFFAOYSA-N.
| Molecular formula | C9H10N2O2 |
|---|---|
| Molecular weight | 178.19 g/mol |
| IUPAC name | 4-methyl-5-nitro-2,3-dihydro-1H-indole |
| InChIKey | XZXMLIIFZFXIHW-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC2=C1CCN2)[N+](=O)[O-] |
Computed by PubChem (NCBI)