CAS 16555-60-5 appears in our catalog under these names: (2-Chloro-benzoylamino)-acetic acid, 95%, 2-Chloro Hippuric Acid, >95% (HPLC), 2-Chlorohippuric acid, N-(2-Cl-Bz)-Gly-OH 98%, 2-(2-Chlorobenzamido)acetic acid, 98%, 98%. Offered by: Combi-blocks, TRC, Biosynth, Ambeed, Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg, 10g, 2,5g, 25g.
2-[(2-chlorobenzoyl)amino]acetic acid (CAS 16555-60-5) is a chemical compound with the molecular formula C9H8ClNO3 and a molecular weight of 213.62 g/mol. IUPAC name: 2-[(2-chlorobenzoyl)amino]acetic acid. InChIKey: GVHWTQYNZUNGIA-UHFFFAOYSA-N.
| Molecular formula | C9H8ClNO3 |
|---|---|
| Molecular weight | 213.62 g/mol |
| IUPAC name | 2-[(2-chlorobenzoyl)amino]acetic acid |
| InChIKey | GVHWTQYNZUNGIA-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)NCC(=O)O)Cl |
Computed by PubChem (NCBI)