Products 1794816-82-2
CAS 1794816-82-2 is the registry number for 2-Chloro Hippuric Acid-d3, >95% (HPLC). Offered by: TRC. Available pack sizes: 2,5mg, 25mg.
2-[(2-chloro-6-deuteriobenzoyl)amino]-2,2-dideuterioacetic acid (CAS 1794816-82-2) is a chemical compound with the molecular formula C9H8ClNO3 and a molecular weight of 216.63 g/mol. IUPAC name: 2-[(2-chloro-6-deuteriobenzoyl)amino]-2,2-dideuterioacetic acid. InChIKey: GVHWTQYNZUNGIA-JXIVCAPZSA-N.
| Molecular formula | C9H8ClNO3 |
|---|---|
| Molecular weight | 216.63 g/mol |
| IUPAC name | 2-[(2-chloro-6-deuteriobenzoyl)amino]-2,2-dideuterioacetic acid |
| InChIKey | GVHWTQYNZUNGIA-JXIVCAPZSA-N |
| SMILES | [2H]C1=C(C(=CC=C1)Cl)C(=O)NC([2H])([2H])C(=O)O |
Computed by PubChem (NCBI)