CAS 16574-10-0 is the registry number for 6,7-Dihydroxy-3-methyl-2H-chromen-2-one, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
6,7-dihydroxy-3-methylchromen-2-one (CAS 16574-10-0) is a chemical compound with the molecular formula C10H8O4 and a molecular weight of 192.17 g/mol. IUPAC name: 6,7-dihydroxy-3-methylchromen-2-one. InChIKey: AUKPTCDSMZHDDA-UHFFFAOYSA-N.
| Molecular formula | C10H8O4 |
|---|---|
| Molecular weight | 192.17 g/mol |
| IUPAC name | 6,7-dihydroxy-3-methylchromen-2-one |
| InChIKey | AUKPTCDSMZHDDA-UHFFFAOYSA-N |
| SMILES | CC1=CC2=CC(=C(C=C2OC1=O)O)O |
Computed by PubChem (NCBI)