CAS 16633-44-6 appears in our catalog under these names: trans–2–(p–tolyl)cyclopropane–1–carboxylic acid, rac-(1R,2R)-2-(4-Methylphenyl)cyclopropane-1-carboxylic acid. Offered by: GLPBio, Biosynth, Chemat. Available pack sizes: 1g, 500mg, 5g, 250mg, 2,5g.
Trans-(1R,2R)-2-(4-methylphenyl)cyclopropane-1-carboxylic acid (CAS 16633-44-6) is a chemical compound with the molecular formula C11H12O2 and a molecular weight of 176.21 g/mol. IUPAC name: trans-(1R,2R)-2-(4-methylphenyl)cyclopropane-1-carboxylic acid. InChIKey: GAGYDDATWSBNEG-VHSXEESVSA-N.
| Molecular formula | C11H12O2 |
|---|---|
| Molecular weight | 176.21 g/mol |
| IUPAC name | trans-(1R,2R)-2-(4-methylphenyl)cyclopropane-1-carboxylic acid |
| InChIKey | GAGYDDATWSBNEG-VHSXEESVSA-N |
| SMILES | CC1=CC=C(C=C1)[C@@H]2C[C@H]2C(=O)O |
Computed by PubChem (NCBI)