CAS 869941-94-6 appears in our catalog under these names: 2-(4-Methylphenyl)cyclopropane-1-carboxylic acid, 95%, 2- p -Tolyl-cyclopropanecarboxylic acid. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 1g, 2,5g.
2-(4-methylphenyl)cyclopropane-1-carboxylic acid (CAS 869941-94-6) is a chemical compound with the molecular formula C11H12O2 and a molecular weight of 176.21 g/mol. IUPAC name: 2-(4-methylphenyl)cyclopropane-1-carboxylic acid. InChIKey: GAGYDDATWSBNEG-UHFFFAOYSA-N.
| Molecular formula | C11H12O2 |
|---|---|
| Molecular weight | 176.21 g/mol |
| IUPAC name | 2-(4-methylphenyl)cyclopropane-1-carboxylic acid |
| InChIKey | GAGYDDATWSBNEG-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C2CC2C(=O)O |
Computed by PubChem (NCBI)